C28H30N4O2 — CID 59170912
(E)-3-[3-ethoxy-4-(4-methylimidazol-1-yl)phenyl]-1-(4-indol-1-ylpiperidin-1-yl)prop-2-en-1-one (PubChem CID 59170912) has the molecular formula C28H30N4O2 and a molecular weight of 454.57 g/mol. Its IUPAC name is (E)-3-[3-ethoxy-4-(4-methylimidazol-1-yl)phenyl]-1-(4-indol-1-ylpiperidin-1-yl)prop-2-en-1-one.
| Compound Name | (E)-3-[3-ethoxy-4-(4-methylimidazol-1-yl)phenyl]-1-(4-indol-1-ylpiperidin-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 59170912 |
| Molecular Formula | C28H30N4O2 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.24 |
| IUPAC Name | (E)-3-[3-ethoxy-4-(4-methylimidazol-1-yl)phenyl]-1-(4-indol-1-ylpiperidin-1-yl)prop-2-en-1-one |
| SMILES | CCOc1cc(/C=C/C(=O)N2CCC(n3ccc4ccccc43)CC2)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C28H30N4O2/c1-3-34-27-18-22(8-10-26(27)31-19-21(2)29-20-31)9-11-28(33)30-15-13-24(14-16-30)32-17-12-23-6-4-5-7-25(23)32/h4-12,17-20,24H,3,13-16H2,1-2H3/b11-9+ |
| InChIKey | SNKLRLLTSTUCGH-PKNBQFBNSA-N |
| XLogP | 5.41 |
| TPSA | 52.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|