C27H49N5O9S — CID 59173074
(2S)-6-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoyl-methylamino]-2-[[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]acetyl]amino]hexanoic acid (PubChem CID 59173074) has the molecular formula C27H49N5O9S and a molecular weight of 619.78 g/mol. Its IUPAC name is (2S)-6-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoyl-methylamino]-2-[[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]acetyl]amino]hexanoic acid.
| Compound Name | (2S)-6-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoyl-methylamino]-2-[[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]acetyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 59173074 |
| Molecular Formula | C27H49N5O9S |
| Molecular Weight | 619.78 g/mol |
| Exact Mass | 619.33 |
| IUPAC Name | (2S)-6-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoyl-methylamino]-2-[[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]acetyl]amino]hexanoic acid |
| SMILES | CN(CCCC[C@H](NC(=O)COCCOCCOCCOCCN)C(=O)O)C(=O)CCCC[C@@H]1SC[C@@H]2NC(=O)N[C@@H]21 |
| InChI | InChI=1S/C27H49N5O9S/c1-32(24(34)8-3-2-7-22-25-21(19-42-22)30-27(37)31-25)10-5-4-6-20(26(35)36)29-23(33)18-41-17-16-40-15-14-39-13-12-38-11-9-28/h20-22,25H,2-19,28H2,1H3,(H,29,33)(H,35,36)(H2,30,31,37)/t20-,21-,22-,25-/m0/s1 |
| InChIKey | OLMPEHSSIGSFOW-UEOMBKFZSA-N |
| XLogP | -0.06 |
| TPSA | 190.78 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.78 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|