C21H21FN4O4 — CID 59174372
methyl 3-[[5-fluoro-2-[4-(2-methoxyethoxy)anilino]pyrimidin-4-yl]amino]benzoate (PubChem CID 59174372) has the molecular formula C21H21FN4O4 and a molecular weight of 412.42 g/mol. Its IUPAC name is methyl 3-[[5-fluoro-2-[4-(2-methoxyethoxy)anilino]pyrimidin-4-yl]amino]benzoate.
| Compound Name | methyl 3-[[5-fluoro-2-[4-(2-methoxyethoxy)anilino]pyrimidin-4-yl]amino]benzoate |
|---|---|
| PubChem CID | 59174372 |
| Molecular Formula | C21H21FN4O4 |
| Molecular Weight | 412.42 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | methyl 3-[[5-fluoro-2-[4-(2-methoxyethoxy)anilino]pyrimidin-4-yl]amino]benzoate |
| SMILES | COCCOc1ccc(Nc2ncc(F)c(Nc3cccc(C(=O)OC)c3)n2)cc1 |
| InChI | InChI=1S/C21H21FN4O4/c1-28-10-11-30-17-8-6-15(7-9-17)25-21-23-13-18(22)19(26-21)24-16-5-3-4-14(12-16)20(27)29-2/h3-9,12-13H,10-11H2,1-2H3,(H2,23,24,25,26) |
| InChIKey | WUYPGWRMHWUNFZ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 94.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.42 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|