C24H28FN5O4 — CID 59174550
1-[2-[3-[[5-fluoro-4-[(3R)-1-prop-2-enoylpiperidin-3-yl]oxypyrimidin-2-yl]amino]phenoxy]ethyl]pyrrolidin-2-one (PubChem CID 59174550) has the molecular formula C24H28FN5O4 and a molecular weight of 469.52 g/mol. Its IUPAC name is 1-[2-[3-[[5-fluoro-4-[(3R)-1-prop-2-enoylpiperidin-3-yl]oxypyrimidin-2-yl]amino]phenoxy]ethyl]pyrrolidin-2-one.
| Compound Name | 1-[2-[3-[[5-fluoro-4-[(3R)-1-prop-2-enoylpiperidin-3-yl]oxypyrimidin-2-yl]amino]phenoxy]ethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 59174550 |
| Molecular Formula | C24H28FN5O4 |
| Molecular Weight | 469.52 g/mol |
| Exact Mass | 469.21 |
| IUPAC Name | 1-[2-[3-[[5-fluoro-4-[(3R)-1-prop-2-enoylpiperidin-3-yl]oxypyrimidin-2-yl]amino]phenoxy]ethyl]pyrrolidin-2-one |
| SMILES | C=CC(=O)N1CCC[C@@H](Oc2nc(Nc3cccc(OCCN4CCCC4=O)c3)ncc2F)C1 |
| InChI | InChI=1S/C24H28FN5O4/c1-2-21(31)30-11-4-8-19(16-30)34-23-20(25)15-26-24(28-23)27-17-6-3-7-18(14-17)33-13-12-29-10-5-9-22(29)32/h2-3,6-7,14-15,19H,1,4-5,8-13,16H2,(H,26,27,28)/t19-/m1/s1 |
| InChIKey | ZVUWDZICRBMEQZ-LJQANCHMSA-N |
| XLogP | 2.92 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.52 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|