C27H30FN5O4 — CID 122463681
N-[[4-[5-fluoro-2-[3-(2-morpholin-4-ylethoxy)anilino]pyrimidin-4-yl]oxyphenyl]methyl]-N-methylprop-2-enamide (PubChem CID 122463681) has the molecular formula C27H30FN5O4 and a molecular weight of 507.57 g/mol. Its IUPAC name is N-[[4-[5-fluoro-2-[3-(2-morpholin-4-ylethoxy)anilino]pyrimidin-4-yl]oxyphenyl]methyl]-N-methylprop-2-enamide.
| Compound Name | N-[[4-[5-fluoro-2-[3-(2-morpholin-4-ylethoxy)anilino]pyrimidin-4-yl]oxyphenyl]methyl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 122463681 |
| Molecular Formula | C27H30FN5O4 |
| Molecular Weight | 507.57 g/mol |
| Exact Mass | 507.23 |
| IUPAC Name | N-[[4-[5-fluoro-2-[3-(2-morpholin-4-ylethoxy)anilino]pyrimidin-4-yl]oxyphenyl]methyl]-N-methylprop-2-enamide |
| SMILES | C=CC(=O)N(C)Cc1ccc(Oc2nc(Nc3cccc(OCCN4CCOCC4)c3)ncc2F)cc1 |
| InChI | InChI=1S/C27H30FN5O4/c1-3-25(34)32(2)19-20-7-9-22(10-8-20)37-26-24(28)18-29-27(31-26)30-21-5-4-6-23(17-21)36-16-13-33-11-14-35-15-12-33/h3-10,17-18H,1,11-16,19H2,2H3,(H,29,30,31) |
| InChIKey | UKFNRFPKZPWLFM-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 89.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.57 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|