C23H25N3O3 — CID 59175169
N-[5-(1H-benzimidazol-2-yl)-1-bicyclo[3.1.1]heptanyl]-3,5-dimethoxybenzamide (PubChem CID 59175169) has the molecular formula C23H25N3O3 and a molecular weight of 391.47 g/mol. Its IUPAC name is N-[5-(1H-benzimidazol-2-yl)-1-bicyclo[3.1.1]heptanyl]-3,5-dimethoxybenzamide.
| Compound Name | N-[5-(1H-benzimidazol-2-yl)-1-bicyclo[3.1.1]heptanyl]-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 59175169 |
| Molecular Formula | C23H25N3O3 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | N-[5-(1H-benzimidazol-2-yl)-1-bicyclo[3.1.1]heptanyl]-3,5-dimethoxybenzamide |
| SMILES | COc1cc(OC)cc(C(=O)NC23CCCC(c4nc5ccccc5[nH]4)(C2)C3)c1 |
| InChI | InChI=1S/C23H25N3O3/c1-28-16-10-15(11-17(12-16)29-2)20(27)26-23-9-5-8-22(13-23,14-23)21-24-18-6-3-4-7-19(18)25-21/h3-4,6-7,10-12H,5,8-9,13-14H2,1-2H3,(H,24,25)(H,26,27) |
| InChIKey | PZLPTJDVPUPQLP-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |