C19H18IN3O3 — CID 59175639
methyl 2-[4-[(6-iodoimidazo[1,2-a]pyridin-2-yl)carbamoyl]phenyl]-2-methylpropanoate (PubChem CID 59175639) has the molecular formula C19H18IN3O3 and a molecular weight of 463.28 g/mol. Its IUPAC name is methyl 2-[4-[(6-iodoimidazo[1,2-a]pyridin-2-yl)carbamoyl]phenyl]-2-methylpropanoate.
| Compound Name | methyl 2-[4-[(6-iodoimidazo[1,2-a]pyridin-2-yl)carbamoyl]phenyl]-2-methylpropanoate |
|---|---|
| PubChem CID | 59175639 |
| Molecular Formula | C19H18IN3O3 |
| Molecular Weight | 463.28 g/mol |
| Exact Mass | 463.04 |
| IUPAC Name | methyl 2-[4-[(6-iodoimidazo[1,2-a]pyridin-2-yl)carbamoyl]phenyl]-2-methylpropanoate |
| SMILES | COC(=O)C(C)(C)c1ccc(C(=O)Nc2cn3cc(I)ccc3n2)cc1 |
| InChI | InChI=1S/C19H18IN3O3/c1-19(2,18(25)26-3)13-6-4-12(5-7-13)17(24)22-15-11-23-10-14(20)8-9-16(23)21-15/h4-11H,1-3H3,(H,22,24) |
| InChIKey | FBGWLLCALYCYMH-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.28 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|