C24H32ClN3O2Si — CID 68661308
4-[1-[tert-butyl(dimethyl)silyl]oxy-2-methylpropan-2-yl]-N-(6-chloroimidazo[1,2-a]pyridin-2-yl)benzamide (PubChem CID 68661308) has the molecular formula C24H32ClN3O2Si and a molecular weight of 458.08 g/mol. Its IUPAC name is 4-[1-[tert-butyl(dimethyl)silyl]oxy-2-methylpropan-2-yl]-N-(6-chloroimidazo[1,2-a]pyridin-2-yl)benzamide.
| Compound Name | 4-[1-[tert-butyl(dimethyl)silyl]oxy-2-methylpropan-2-yl]-N-(6-chloroimidazo[1,2-a]pyridin-2-yl)benzamide |
|---|---|
| PubChem CID | 68661308 |
| Molecular Formula | C24H32ClN3O2Si |
| Molecular Weight | 458.08 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | 4-[1-[tert-butyl(dimethyl)silyl]oxy-2-methylpropan-2-yl]-N-(6-chloroimidazo[1,2-a]pyridin-2-yl)benzamide |
| SMILES | CC(C)(CO[Si](C)(C)C(C)(C)C)c1ccc(C(=O)Nc2cn3cc(Cl)ccc3n2)cc1 |
| InChI | InChI=1S/C24H32ClN3O2Si/c1-23(2,3)31(6,7)30-16-24(4,5)18-10-8-17(9-11-18)22(29)27-20-15-28-14-19(25)12-13-21(28)26-20/h8-15H,16H2,1-7H3,(H,27,29) |
| InChIKey | VAMJDCDAKWJKAT-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.08 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|