C20H19IN4O — CID 59175307
4-(4-cyano-2-methylbutan-2-yl)-N-(6-iodoimidazo[1,2-a]pyridin-2-yl)benzamide (PubChem CID 59175307) has the molecular formula C20H19IN4O and a molecular weight of 458.30 g/mol. Its IUPAC name is 4-(4-cyano-2-methylbutan-2-yl)-N-(6-iodoimidazo[1,2-a]pyridin-2-yl)benzamide.
| Compound Name | 4-(4-cyano-2-methylbutan-2-yl)-N-(6-iodoimidazo[1,2-a]pyridin-2-yl)benzamide |
|---|---|
| PubChem CID | 59175307 |
| Molecular Formula | C20H19IN4O |
| Molecular Weight | 458.30 g/mol |
| Exact Mass | 458.06 |
| IUPAC Name | 4-(4-cyano-2-methylbutan-2-yl)-N-(6-iodoimidazo[1,2-a]pyridin-2-yl)benzamide |
| SMILES | CC(C)(CCC#N)c1ccc(C(=O)Nc2cn3cc(I)ccc3n2)cc1 |
| InChI | InChI=1S/C20H19IN4O/c1-20(2,10-3-11-22)15-6-4-14(5-7-15)19(26)24-17-13-25-12-16(21)8-9-18(25)23-17/h4-9,12-13H,3,10H2,1-2H3,(H,24,26) |
| InChIKey | HSOHHAANNUTZPW-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 70.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.30 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|