C36H52N2O6 — CID 59176144
3-[(1S,3R,4S)-3-(4-methoxyphenyl)-4-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]cyclohexyl]-2,2-dimethyl-N-(oxan-4-yl)propanamide (PubChem CID 59176144) has the molecular formula C36H52N2O6 and a molecular weight of 608.82 g/mol. Its IUPAC name is 3-[(1S,3R,4S)-3-(4-methoxyphenyl)-4-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]cyclohexyl]-2,2-dimethyl-N-(oxan-4-yl)propanamide.
| Compound Name | 3-[(1S,3R,4S)-3-(4-methoxyphenyl)-4-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]cyclohexyl]-2,2-dimethyl-N-(oxan-4-yl)propanamide |
|---|---|
| PubChem CID | 59176144 |
| Molecular Formula | C36H52N2O6 |
| Molecular Weight | 608.82 g/mol |
| Exact Mass | 608.38 |
| IUPAC Name | 3-[(1S,3R,4S)-3-(4-methoxyphenyl)-4-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]cyclohexyl]-2,2-dimethyl-N-(oxan-4-yl)propanamide |
| SMILES | COCCCN1CCOc2ccc(CO[C@H]3CC[C@H](CC(C)(C)C(=O)NC4CCOCC4)C[C@@H]3c3ccc(OC)cc3)cc21 |
| InChI | InChI=1S/C36H52N2O6/c1-36(2,35(39)37-29-14-19-42-20-15-29)24-26-6-12-33(31(22-26)28-8-10-30(41-4)11-9-28)44-25-27-7-13-34-32(23-27)38(17-21-43-34)16-5-18-40-3/h7-11,13,23,26,29,31,33H,5-6,12,14-22,24-25H2,1-4H3,(H,37,39)/t26-,31+,33-/m0/s1 |
| InChIKey | VFZADXWTDNBUFL-LBXLJHCKSA-N |
| XLogP | 6.11 |
| TPSA | 78.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.82 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|