C40H46N2O5 — CID 59176239
(1R,3R,4S)-3-(4-methoxyphenyl)-4-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-N-[(3-phenylphenyl)methyl]cyclohexane-1-carboxamide (PubChem CID 59176239) has the molecular formula C40H46N2O5 and a molecular weight of 634.82 g/mol. Its IUPAC name is (1R,3R,4S)-3-(4-methoxyphenyl)-4-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-N-[(3-phenylphenyl)methyl]cyclohexane-1-carboxamide.
| Compound Name | (1R,3R,4S)-3-(4-methoxyphenyl)-4-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-N-[(3-phenylphenyl)methyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 59176239 |
| Molecular Formula | C40H46N2O5 |
| Molecular Weight | 634.82 g/mol |
| Exact Mass | 634.34 |
| IUPAC Name | (1R,3R,4S)-3-(4-methoxyphenyl)-4-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-N-[(3-phenylphenyl)methyl]cyclohexane-1-carboxamide |
| SMILES | COCCCN1CCOc2ccc(CO[C@H]3CC[C@@H](C(=O)NCc4cccc(-c5ccccc5)c4)C[C@@H]3c3ccc(OC)cc3)cc21 |
| InChI | InChI=1S/C40H46N2O5/c1-44-22-7-20-42-21-23-46-39-18-12-30(25-37(39)42)28-47-38-19-15-34(26-36(38)32-13-16-35(45-2)17-14-32)40(43)41-27-29-8-6-11-33(24-29)31-9-4-3-5-10-31/h3-6,8-14,16-18,24-25,34,36,38H,7,15,19-23,26-28H2,1-2H3,(H,41,43)/t34-,36-,38+/m1/s1 |
| InChIKey | ZWNJKRSCUQNHHM-GBEDDAJDSA-N |
| XLogP | 7.38 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.82 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|