C33H34N2O4 — CID 91758309
4-methoxy-3-(3-methoxyphenyl)-N-[4-[4-(1-methylpiperidin-4-yl)oxyphenyl]phenyl]benzamide (PubChem CID 91758309) has the molecular formula C33H34N2O4 and a molecular weight of 522.65 g/mol. Its IUPAC name is 4-methoxy-3-(3-methoxyphenyl)-N-[4-[4-(1-methylpiperidin-4-yl)oxyphenyl]phenyl]benzamide.
| Compound Name | 4-methoxy-3-(3-methoxyphenyl)-N-[4-[4-(1-methylpiperidin-4-yl)oxyphenyl]phenyl]benzamide |
|---|---|
| PubChem CID | 91758309 |
| Molecular Formula | C33H34N2O4 |
| Molecular Weight | 522.65 g/mol |
| Exact Mass | 522.25 |
| IUPAC Name | 4-methoxy-3-(3-methoxyphenyl)-N-[4-[4-(1-methylpiperidin-4-yl)oxyphenyl]phenyl]benzamide |
| SMILES | COc1cccc(-c2cc(C(=O)Nc3ccc(-c4ccc(OC5CCN(C)CC5)cc4)cc3)ccc2OC)c1 |
| InChI | InChI=1S/C33H34N2O4/c1-35-19-17-29(18-20-35)39-28-14-9-24(10-15-28)23-7-12-27(13-8-23)34-33(36)26-11-16-32(38-3)31(22-26)25-5-4-6-30(21-25)37-2/h4-16,21-22,29H,17-20H2,1-3H3,(H,34,36) |
| InChIKey | PRHXJKZSDHHJAR-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.65 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |