C38H39N3O7 — CID 118735133
N-[3-[2-(1-adamantylamino)ethyl]-2,9-dioxo-1H-pyrano[2,3-f][1,4]benzoxazin-8-yl]-4-methoxy-3-(3-methoxyphenyl)benzamide (PubChem CID 118735133) has the molecular formula C38H39N3O7 and a molecular weight of 649.74 g/mol. Its IUPAC name is N-[3-[2-(1-adamantylamino)ethyl]-2,9-dioxo-1H-pyrano[2,3-f][1,4]benzoxazin-8-yl]-4-methoxy-3-(3-methoxyphenyl)benzamide.
| Compound Name | N-[3-[2-(1-adamantylamino)ethyl]-2,9-dioxo-1H-pyrano[2,3-f][1,4]benzoxazin-8-yl]-4-methoxy-3-(3-methoxyphenyl)benzamide |
|---|---|
| PubChem CID | 118735133 |
| Molecular Formula | C38H39N3O7 |
| Molecular Weight | 649.74 g/mol |
| Exact Mass | 649.28 |
| IUPAC Name | N-[3-[2-(1-adamantylamino)ethyl]-2,9-dioxo-1H-pyrano[2,3-f][1,4]benzoxazin-8-yl]-4-methoxy-3-(3-methoxyphenyl)benzamide |
| SMILES | COc1cccc(-c2cc(C(=O)Nc3cc4ccc5c(c4oc3=O)NC(=O)C(CCNC34CC6CC(CC(C6)C3)C4)O5)ccc2OC)c1 |
| InChI | InChI=1S/C38H39N3O7/c1-45-27-5-3-4-24(15-27)28-16-26(7-8-30(28)46-2)35(42)40-29-17-25-6-9-31-33(34(25)48-37(29)44)41-36(43)32(47-31)10-11-39-38-18-21-12-22(19-38)14-23(13-21)20-38/h3-9,15-17,21-23,32,39H,10-14,18-20H2,1-2H3,(H,40,42)(H,41,43) |
| InChIKey | GPXUFDVZBJFYSM-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 128.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.74 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|