C13H25N — CID 59179882
(Z)-N-tert-butyl-3,5,5-trimethylhex-3-en-2-imine (PubChem CID 59179882) has the molecular formula C13H25N and a molecular weight of 195.35 g/mol. Its IUPAC name is (Z)-N-tert-butyl-3,5,5-trimethylhex-3-en-2-imine.
| Compound Name | (Z)-N-tert-butyl-3,5,5-trimethylhex-3-en-2-imine |
|---|---|
| PubChem CID | 59179882 |
| Molecular Formula | C13H25N |
| Molecular Weight | 195.35 g/mol |
| Exact Mass | 195.20 |
| IUPAC Name | (Z)-N-tert-butyl-3,5,5-trimethylhex-3-en-2-imine |
| SMILES | CC(=C/C(C)(C)C)/C(C)=N/C(C)(C)C |
| InChI | InChI=1S/C13H25N/c1-10(9-12(3,4)5)11(2)14-13(6,7)8/h9H,1-8H3/b10-9-,14-11+ |
| InChIKey | PBHBPCNLHDSZIE-TVFNDYRWSA-N |
| XLogP | 4.24 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.35 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|