C7H13N — CID 58898687
N,3-dimethylpent-3-en-2-imine (PubChem CID 58898687) has the molecular formula C7H13N and a molecular weight of 111.19 g/mol. Its IUPAC name is N,3-dimethylpent-3-en-2-imine.
| Compound Name | N,3-dimethylpent-3-en-2-imine |
|---|---|
| PubChem CID | 58898687 |
| Molecular Formula | C7H13N |
| Molecular Weight | 111.19 g/mol |
| Exact Mass | 111.10 |
| IUPAC Name | N,3-dimethylpent-3-en-2-imine |
| SMILES | CC=C(C)/C(C)=N/C |
| InChI | InChI=1S/C7H13N/c1-5-6(2)7(3)8-4/h5H,1-4H3/b6-5?,8-7+ |
| InChIKey | UNZBVAYOXJXDLI-GCSGCOTJSA-N |
| XLogP | 2.04 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 111.19 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|