C20H17N5O3S — CID 59179896
[2-(6-morpholin-4-yl-3-phenylpyrazolo[5,4-b]pyridin-1-yl)-1,3-thiazol-4-yl] formate (PubChem CID 59179896) has the molecular formula C20H17N5O3S and a molecular weight of 407.46 g/mol. Its IUPAC name is [2-(6-morpholin-4-yl-3-phenylpyrazolo[5,4-b]pyridin-1-yl)-1,3-thiazol-4-yl] formate.
| Compound Name | [2-(6-morpholin-4-yl-3-phenylpyrazolo[5,4-b]pyridin-1-yl)-1,3-thiazol-4-yl] formate |
|---|---|
| PubChem CID | 59179896 |
| Molecular Formula | C20H17N5O3S |
| Molecular Weight | 407.46 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | [2-(6-morpholin-4-yl-3-phenylpyrazolo[5,4-b]pyridin-1-yl)-1,3-thiazol-4-yl] formate |
| SMILES | O=COc1csc(-n2nc(-c3ccccc3)c3ccc(N4CCOCC4)nc32)n1 |
| InChI | InChI=1S/C20H17N5O3S/c26-13-28-17-12-29-20(22-17)25-19-15(18(23-25)14-4-2-1-3-5-14)6-7-16(21-19)24-8-10-27-11-9-24/h1-7,12-13H,8-11H2 |
| InChIKey | ZKYGUCNAKYSGNO-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 82.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.46 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|