C13H18FN5O2 — CID 59185474
[(2S,3R,4R,5S)-5-(2,4-diaminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-fluoro-3,4-dimethyloxolan-2-yl]methanol (PubChem CID 59185474) has the molecular formula C13H18FN5O2 and a molecular weight of 295.32 g/mol. Its IUPAC name is [(2S,3R,4R,5S)-5-(2,4-diaminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-fluoro-3,4-dimethyloxolan-2-yl]methanol.
| Compound Name | [(2S,3R,4R,5S)-5-(2,4-diaminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-fluoro-3,4-dimethyloxolan-2-yl]methanol |
|---|---|
| PubChem CID | 59185474 |
| Molecular Formula | C13H18FN5O2 |
| Molecular Weight | 295.32 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | [(2S,3R,4R,5S)-5-(2,4-diaminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-fluoro-3,4-dimethyloxolan-2-yl]methanol |
| SMILES | C[C@@H]1[C@@H](CO)O[C@@H](c2ccc3c(N)nc(N)nn23)[C@]1(C)F |
| InChI | InChI=1S/C13H18FN5O2/c1-6-9(5-20)21-10(13(6,2)14)7-3-4-8-11(15)17-12(16)18-19(7)8/h3-4,6,9-10,20H,5H2,1-2H3,(H4,15,16,17,18)/t6-,9-,10+,13-/m1/s1 |
| InChIKey | UOPMGBUXPMPGGN-FAYBLGNRSA-N |
| XLogP | 0.69 |
| TPSA | 111.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.32 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |