C26H24ClN3O3 — CID 59190236
2-chloro-N-(1-methylpiperidin-4-yl)-5-[5-[(E)-(2-oxo-1H-indol-3-ylidene)methyl]furan-2-yl]benzamide (PubChem CID 59190236) has the molecular formula C26H24ClN3O3 and a molecular weight of 461.95 g/mol. Its IUPAC name is 2-chloro-N-(1-methylpiperidin-4-yl)-5-[5-[(E)-(2-oxo-1H-indol-3-ylidene)methyl]furan-2-yl]benzamide.
| Compound Name | 2-chloro-N-(1-methylpiperidin-4-yl)-5-[5-[(E)-(2-oxo-1H-indol-3-ylidene)methyl]furan-2-yl]benzamide |
|---|---|
| PubChem CID | 59190236 |
| Molecular Formula | C26H24ClN3O3 |
| Molecular Weight | 461.95 g/mol |
| Exact Mass | 461.15 |
| IUPAC Name | 2-chloro-N-(1-methylpiperidin-4-yl)-5-[5-[(E)-(2-oxo-1H-indol-3-ylidene)methyl]furan-2-yl]benzamide |
| SMILES | CN1CCC(NC(=O)c2cc(-c3ccc(/C=C4/C(=O)Nc5ccccc54)o3)ccc2Cl)CC1 |
| InChI | InChI=1S/C26H24ClN3O3/c1-30-12-10-17(11-13-30)28-26(32)21-14-16(6-8-22(21)27)24-9-7-18(33-24)15-20-19-4-2-3-5-23(19)29-25(20)31/h2-9,14-15,17H,10-13H2,1H3,(H,28,32)(H,29,31)/b20-15+ |
| InChIKey | CQZHQJKQKRDQFL-HMMYKYKNSA-N |
| XLogP | 4.92 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.95 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|