C38H33N — CID 59196951
N-(4-butan-2-ylphenyl)-N-[4-(6-phenylnaphthalen-2-yl)phenyl]-3-tritioaniline (PubChem CID 59196951) has the molecular formula C38H33N and a molecular weight of 505.70 g/mol. Its IUPAC name is N-(4-butan-2-ylphenyl)-N-[4-(6-phenylnaphthalen-2-yl)phenyl]-3-tritioaniline.
| Compound Name | N-(4-butan-2-ylphenyl)-N-[4-(6-phenylnaphthalen-2-yl)phenyl]-3-tritioaniline |
|---|---|
| PubChem CID | 59196951 |
| Molecular Formula | C38H33N |
| Molecular Weight | 505.70 g/mol |
| Exact Mass | 505.27 |
| IUPAC Name | N-(4-butan-2-ylphenyl)-N-[4-(6-phenylnaphthalen-2-yl)phenyl]-3-tritioaniline |
| SMILES | [3H]c1cccc(N(c2ccc(-c3ccc4cc(-c5ccccc5)ccc4c3)cc2)c2ccc(C(C)CC)cc2)c1 |
| InChI | InChI=1S/C38H33N/c1-3-28(2)29-18-22-37(23-19-29)39(36-12-8-5-9-13-36)38-24-20-31(21-25-38)33-15-17-34-26-32(14-16-35(34)27-33)30-10-6-4-7-11-30/h4-28H,3H2,1-2H3/i8T |
| InChIKey | TVZMWHZJZJNXQL-WTRHXODISA-N |
| XLogP | 11.16 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.70 |
| LogP ≤ 5 | 11.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |