C23H30NO3PS — CID 59202125
[5-[3-[1-(4-hexylphenyl)pyrrol-2-yl]propyl]thiophen-2-yl]phosphonic acid (PubChem CID 59202125) has the molecular formula C23H30NO3PS and a molecular weight of 431.54 g/mol. Its IUPAC name is [5-[3-[1-(4-hexylphenyl)pyrrol-2-yl]propyl]thiophen-2-yl]phosphonic acid.
| Compound Name | [5-[3-[1-(4-hexylphenyl)pyrrol-2-yl]propyl]thiophen-2-yl]phosphonic acid |
|---|---|
| PubChem CID | 59202125 |
| Molecular Formula | C23H30NO3PS |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | [5-[3-[1-(4-hexylphenyl)pyrrol-2-yl]propyl]thiophen-2-yl]phosphonic acid |
| SMILES | CCCCCCc1ccc(-n2cccc2CCCc2ccc(P(=O)(O)O)s2)cc1 |
| InChI | InChI=1S/C23H30NO3PS/c1-2-3-4-5-8-19-12-14-21(15-13-19)24-18-7-10-20(24)9-6-11-22-16-17-23(29-22)28(25,26)27/h7,10,12-18H,2-6,8-9,11H2,1H3,(H2,25,26,27) |
| InChIKey | KMKTYTLABJQEPY-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|