C25H23N2O5S — CID 59206045
CID 59206045 (PubChem CID 59206045) has the molecular formula C25H23N2O5S and a molecular weight of 463.54 g/mol.
| Compound Name | CID 59206045 |
|---|---|
| PubChem CID | 59206045 |
| Molecular Formula | C25H23N2O5S |
| Molecular Weight | 463.54 g/mol |
| Exact Mass | 463.13 |
| IUPAC Name | — |
| SMILES | CCc1ccc(NC(=O)C2(c3ccc4c(c3)OCO4)CC2)cc1-c1cccc(S([NH])(=O)=O)c1 |
| InChI | InChI=1S/C25H23N2O5S/c1-2-16-6-8-19(14-21(16)17-4-3-5-20(12-17)33(26,29)30)27-24(28)25(10-11-25)18-7-9-22-23(13-18)32-15-31-22/h3-9,12-14,26H,2,10-11,15H2,1H3,(H,27,28) |
| InChIKey | NAVZPIRMTKNYAU-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 105.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.54 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |