C24H21N2O6S — CID 59256231
CID 59256231 (PubChem CID 59256231) has the molecular formula C24H21N2O6S and a molecular weight of 465.51 g/mol.
| Compound Name | CID 59256231 |
|---|---|
| PubChem CID | 59256231 |
| Molecular Formula | C24H21N2O6S |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.11 |
| IUPAC Name | — |
| SMILES | COc1ccc(NC(=O)C2(c3ccc4c(c3)OCO4)CC2)cc1-c1cccc(S([NH])(=O)=O)c1 |
| InChI | InChI=1S/C24H21N2O6S/c1-30-20-8-6-17(13-19(20)15-3-2-4-18(11-15)33(25,28)29)26-23(27)24(9-10-24)16-5-7-21-22(12-16)32-14-31-21/h2-8,11-13,25H,9-10,14H2,1H3,(H,26,27) |
| InChIKey | IKTBMMFYPCZLIT-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 114.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |