C24H21N2O5S — CID 59206976
CID 59206976 (PubChem CID 59206976) has the molecular formula C24H21N2O5S and a molecular weight of 449.51 g/mol.
| Compound Name | CID 59206976 |
|---|---|
| PubChem CID | 59206976 |
| Molecular Formula | C24H21N2O5S |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.12 |
| IUPAC Name | — |
| SMILES | Cc1ccc(NC(=O)C2(c3ccc4c(c3)OCO4)CC2)cc1-c1cccc(S([NH])(=O)=O)c1 |
| InChI | InChI=1S/C24H21N2O5S/c1-15-5-7-18(13-20(15)16-3-2-4-19(11-16)32(25,28)29)26-23(27)24(9-10-24)17-6-8-21-22(12-17)31-14-30-21/h2-8,11-13,25H,9-10,14H2,1H3,(H,26,27) |
| InChIKey | CVJPKPXQNBAUCN-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 105.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |