C24H24N2O4 — CID 59206689
1-(1,3-benzodioxol-5-yl)-N-[3-(2,5-dimethylpyrrol-1-yl)-4-methoxyphenyl]cyclopropane-1-carboxamide (PubChem CID 59206689) has the molecular formula C24H24N2O4 and a molecular weight of 404.47 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-N-[3-(2,5-dimethylpyrrol-1-yl)-4-methoxyphenyl]cyclopropane-1-carboxamide.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-N-[3-(2,5-dimethylpyrrol-1-yl)-4-methoxyphenyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 59206689 |
| Molecular Formula | C24H24N2O4 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-N-[3-(2,5-dimethylpyrrol-1-yl)-4-methoxyphenyl]cyclopropane-1-carboxamide |
| SMILES | COc1ccc(NC(=O)C2(c3ccc4c(c3)OCO4)CC2)cc1-n1c(C)ccc1C |
| InChI | InChI=1S/C24H24N2O4/c1-15-4-5-16(2)26(15)19-13-18(7-9-20(19)28-3)25-23(27)24(10-11-24)17-6-8-21-22(12-17)30-14-29-21/h4-9,12-13H,10-11,14H2,1-3H3,(H,25,27) |
| InChIKey | NSDXHXHSRQAYGZ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|