C25H29N5O4S — CID 59208375
ethyl 4-(butylcarbamoyl)-2-[6-(ethylcarbamoylamino)-4-phenyl-3-pyridinyl]-1,3-thiazole-5-carboxylate (PubChem CID 59208375) has the molecular formula C25H29N5O4S and a molecular weight of 495.61 g/mol. Its IUPAC name is ethyl 4-(butylcarbamoyl)-2-[6-(ethylcarbamoylamino)-4-phenyl-3-pyridinyl]-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 4-(butylcarbamoyl)-2-[6-(ethylcarbamoylamino)-4-phenyl-3-pyridinyl]-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 59208375 |
| Molecular Formula | C25H29N5O4S |
| Molecular Weight | 495.61 g/mol |
| Exact Mass | 495.19 |
| IUPAC Name | ethyl 4-(butylcarbamoyl)-2-[6-(ethylcarbamoylamino)-4-phenyl-3-pyridinyl]-1,3-thiazole-5-carboxylate |
| SMILES | CCCCNC(=O)c1nc(-c2cnc(NC(=O)NCC)cc2-c2ccccc2)sc1C(=O)OCC |
| InChI | InChI=1S/C25H29N5O4S/c1-4-7-13-27-22(31)20-21(24(32)34-6-3)35-23(30-20)18-15-28-19(29-25(33)26-5-2)14-17(18)16-11-9-8-10-12-16/h8-12,14-15H,4-7,13H2,1-3H3,(H,27,31)(H2,26,28,29,33) |
| InChIKey | CUTZFMPISCBDJF-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 122.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.61 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|