C35H42N6O3 — CID 59211540
(2,4,6-trimethylcyclohexyl) 5-[4-(diethylamino)-2-methylphenyl]imino-6-isocyano-2-(2-methoxy-5-methylphenyl)pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate (PubChem CID 59211540) has the molecular formula C35H42N6O3 and a molecular weight of 594.76 g/mol. Its IUPAC name is (2,4,6-trimethylcyclohexyl) 5-[4-(diethylamino)-2-methylphenyl]imino-6-isocyano-2-(2-methoxy-5-methylphenyl)pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate.
| Compound Name | (2,4,6-trimethylcyclohexyl) 5-[4-(diethylamino)-2-methylphenyl]imino-6-isocyano-2-(2-methoxy-5-methylphenyl)pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate |
|---|---|
| PubChem CID | 59211540 |
| Molecular Formula | C35H42N6O3 |
| Molecular Weight | 594.76 g/mol |
| Exact Mass | 594.33 |
| IUPAC Name | (2,4,6-trimethylcyclohexyl) 5-[4-(diethylamino)-2-methylphenyl]imino-6-isocyano-2-(2-methoxy-5-methylphenyl)pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate |
| SMILES | [C-]#[N+]C1=C(C(=O)OC2C(C)CC(C)CC2C)c2nc(-c3cc(C)ccc3OC)nn2/C1=N/c1ccc(N(CC)CC)cc1C |
| InChI | InChI=1S/C35H42N6O3/c1-10-40(11-2)25-13-14-27(22(5)19-25)37-34-30(36-8)29(35(42)44-31-23(6)16-21(4)17-24(31)7)33-38-32(39-41(33)34)26-18-20(3)12-15-28(26)43-9/h12-15,18-19,21,23-24,31H,10-11,16-17H2,1-7,9H3/b37-34+ |
| InChIKey | KLAZSVWUMUCAMW-NFSLGCCLSA-N |
| XLogP | 7.25 |
| TPSA | 86.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.76 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|