C45H61N5O4 — CID 72531805
(2,4,6-trimethylcyclohexyl) 5-[[4-[butyl(ethyl)amino]-2-methylphenyl]methylidene]-6-isocyano-2-(2-methoxy-5-octoxyphenyl)pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate (PubChem CID 72531805) has the molecular formula C45H61N5O4 and a molecular weight of 736.01 g/mol. Its IUPAC name is (2,4,6-trimethylcyclohexyl) 5-[[4-[butyl(ethyl)amino]-2-methylphenyl]methylidene]-6-isocyano-2-(2-methoxy-5-octoxyphenyl)pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate.
| Compound Name | (2,4,6-trimethylcyclohexyl) 5-[[4-[butyl(ethyl)amino]-2-methylphenyl]methylidene]-6-isocyano-2-(2-methoxy-5-octoxyphenyl)pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate |
|---|---|
| PubChem CID | 72531805 |
| Molecular Formula | C45H61N5O4 |
| Molecular Weight | 736.01 g/mol |
| Exact Mass | 735.47 |
| IUPAC Name | (2,4,6-trimethylcyclohexyl) 5-[[4-[butyl(ethyl)amino]-2-methylphenyl]methylidene]-6-isocyano-2-(2-methoxy-5-octoxyphenyl)pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate |
| SMILES | [C-]#[N+]c1c(C(=O)OC2C(C)CC(C)CC2C)c2nc(-c3cc(OCCCCCCCC)ccc3OC)nn2c1=Cc1ccc(N(CC)CCCC)cc1C |
| InChI | InChI=1S/C45H61N5O4/c1-10-13-15-16-17-18-24-53-36-21-22-39(52-9)37(29-36)43-47-44-40(45(51)54-42-32(6)25-30(4)26-33(42)7)41(46-8)38(50(44)48-43)28-34-19-20-35(27-31(34)5)49(12-3)23-14-11-2/h19-22,27-30,32-33,42H,10-18,23-26H2,1-7,9H3 |
| InChIKey | XRKNZWOCQDTWBS-UHFFFAOYSA-N |
| XLogP | 10.41 |
| TPSA | 82.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.01 |
| LogP ≤ 5 | 10.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|