C41H44ClN5O3S — CID 59005930
(2,6-dimethylcyclohexyl) (5E)-5-[(Z,4Z)-2-chloro-4-thiochromen-2-ylidenebut-2-enylidene]-6-isocyano-2-(4-octoxy-2-pyridinyl)pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate (PubChem CID 59005930) has the molecular formula C41H44ClN5O3S and a molecular weight of 722.36 g/mol. Its IUPAC name is (2,6-dimethylcyclohexyl) (5E)-5-[(Z,4Z)-2-chloro-4-thiochromen-2-ylidenebut-2-enylidene]-6-isocyano-2-(4-octoxy-2-pyridinyl)pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate.
| Compound Name | (2,6-dimethylcyclohexyl) (5E)-5-[(Z,4Z)-2-chloro-4-thiochromen-2-ylidenebut-2-enylidene]-6-isocyano-2-(4-octoxy-2-pyridinyl)pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate |
|---|---|
| PubChem CID | 59005930 |
| Molecular Formula | C41H44ClN5O3S |
| Molecular Weight | 722.36 g/mol |
| Exact Mass | 721.29 |
| IUPAC Name | (2,6-dimethylcyclohexyl) (5E)-5-[(Z,4Z)-2-chloro-4-thiochromen-2-ylidenebut-2-enylidene]-6-isocyano-2-(4-octoxy-2-pyridinyl)pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate |
| SMILES | [C-]#[N+]c1c(C(=O)OC2C(C)CCCC2C)c2nc(-c3cc(OCCCCCCCC)ccn3)nn2/c1=C/C(Cl)=C/C=C1/C=Cc2ccccc2S1 |
| InChI | InChI=1S/C41H44ClN5O3S/c1-5-6-7-8-9-12-24-49-31-22-23-44-33(26-31)39-45-40-36(41(48)50-38-27(2)14-13-15-28(38)3)37(43-4)34(47(40)46-39)25-30(42)19-21-32-20-18-29-16-10-11-17-35(29)51-32/h10-11,16-23,25-28,38H,5-9,12-15,24H2,1-3H3/b30-19-,32-21-,34-25+ |
| InChIKey | FTWFRUOVVQGXRN-IORDQJJSSA-N |
| XLogP | 10.39 |
| TPSA | 82.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.36 |
| LogP ≤ 5 | 10.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|