C29H23ClO6 — CID 59214929
4-[4-(4-chlorophenyl)phenyl]-2-[2-[(Z)-3-(furan-2-yl)-1-hydroxy-3-oxoprop-1-enyl]phenoxy]butanoic acid (PubChem CID 59214929) has the molecular formula C29H23ClO6 and a molecular weight of 502.95 g/mol. Its IUPAC name is 4-[4-(4-chlorophenyl)phenyl]-2-[2-[(Z)-3-(furan-2-yl)-1-hydroxy-3-oxoprop-1-enyl]phenoxy]butanoic acid.
| Compound Name | 4-[4-(4-chlorophenyl)phenyl]-2-[2-[(Z)-3-(furan-2-yl)-1-hydroxy-3-oxoprop-1-enyl]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 59214929 |
| Molecular Formula | C29H23ClO6 |
| Molecular Weight | 502.95 g/mol |
| Exact Mass | 502.12 |
| IUPAC Name | 4-[4-(4-chlorophenyl)phenyl]-2-[2-[(Z)-3-(furan-2-yl)-1-hydroxy-3-oxoprop-1-enyl]phenoxy]butanoic acid |
| SMILES | O=C(/C=C(\O)c1ccccc1OC(CCc1ccc(-c2ccc(Cl)cc2)cc1)C(=O)O)c1ccco1 |
| InChI | InChI=1S/C29H23ClO6/c30-22-14-12-21(13-15-22)20-10-7-19(8-11-20)9-16-28(29(33)34)36-26-5-2-1-4-23(26)24(31)18-25(32)27-6-3-17-35-27/h1-8,10-15,17-18,28,31H,9,16H2,(H,33,34)/b24-18- |
| InChIKey | RPFRODWMVXTZEY-MOHJPFBDSA-N |
| XLogP | 6.85 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.95 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|