C23H19ClO5 — CID 59215035
2-(1,3-benzodioxol-5-yloxy)-4-[4-(4-chlorophenyl)phenyl]butanoic acid (PubChem CID 59215035) has the molecular formula C23H19ClO5 and a molecular weight of 410.85 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yloxy)-4-[4-(4-chlorophenyl)phenyl]butanoic acid.
| Compound Name | 2-(1,3-benzodioxol-5-yloxy)-4-[4-(4-chlorophenyl)phenyl]butanoic acid |
|---|---|
| PubChem CID | 59215035 |
| Molecular Formula | C23H19ClO5 |
| Molecular Weight | 410.85 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yloxy)-4-[4-(4-chlorophenyl)phenyl]butanoic acid |
| SMILES | O=C(O)C(CCc1ccc(-c2ccc(Cl)cc2)cc1)Oc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C23H19ClO5/c24-18-8-6-17(7-9-18)16-4-1-15(2-5-16)3-11-21(23(25)26)29-19-10-12-20-22(13-19)28-14-27-20/h1-2,4-10,12-13,21H,3,11,14H2,(H,25,26) |
| InChIKey | KPQYGJPGLVASAY-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.85 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |