C32H26Cl2O4 — CID 59214972
4-[4-(4-chlorophenyl)phenyl]-2-[2-[(E)-3-(4-chlorophenyl)prop-2-enoyl]-4-methylphenoxy]butanoic acid (PubChem CID 59214972) has the molecular formula C32H26Cl2O4 and a molecular weight of 545.46 g/mol. Its IUPAC name is 4-[4-(4-chlorophenyl)phenyl]-2-[2-[(E)-3-(4-chlorophenyl)prop-2-enoyl]-4-methylphenoxy]butanoic acid.
| Compound Name | 4-[4-(4-chlorophenyl)phenyl]-2-[2-[(E)-3-(4-chlorophenyl)prop-2-enoyl]-4-methylphenoxy]butanoic acid |
|---|---|
| PubChem CID | 59214972 |
| Molecular Formula | C32H26Cl2O4 |
| Molecular Weight | 545.46 g/mol |
| Exact Mass | 544.12 |
| IUPAC Name | 4-[4-(4-chlorophenyl)phenyl]-2-[2-[(E)-3-(4-chlorophenyl)prop-2-enoyl]-4-methylphenoxy]butanoic acid |
| SMILES | Cc1ccc(OC(CCc2ccc(-c3ccc(Cl)cc3)cc2)C(=O)O)c(C(=O)/C=C/c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C32H26Cl2O4/c1-21-2-18-30(28(20-21)29(35)17-7-23-5-13-26(33)14-6-23)38-31(32(36)37)19-8-22-3-9-24(10-4-22)25-11-15-27(34)16-12-25/h2-7,9-18,20,31H,8,19H2,1H3,(H,36,37)/b17-7+ |
| InChIKey | ZQLKMRCHQBLXCY-REZTVBANSA-N |
| XLogP | 8.33 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.46 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|