C35H35N2S+ — CID 59215562
2-[(E,3E)-3-(3-benzyl-1,3-dimethylbenzo[f]indol-2-ylidene)prop-1-enyl]-3-butyl-1,3-benzothiazol-3-ium (PubChem CID 59215562) has the molecular formula C35H35N2S+ and a molecular weight of 515.75 g/mol. Its IUPAC name is 2-[(E,3E)-3-(3-benzyl-1,3-dimethylbenzo[f]indol-2-ylidene)prop-1-enyl]-3-butyl-1,3-benzothiazol-3-ium.
| Compound Name | 2-[(E,3E)-3-(3-benzyl-1,3-dimethylbenzo[f]indol-2-ylidene)prop-1-enyl]-3-butyl-1,3-benzothiazol-3-ium |
|---|---|
| PubChem CID | 59215562 |
| Molecular Formula | C35H35N2S+ |
| Molecular Weight | 515.75 g/mol |
| Exact Mass | 515.25 |
| IUPAC Name | 2-[(E,3E)-3-(3-benzyl-1,3-dimethylbenzo[f]indol-2-ylidene)prop-1-enyl]-3-butyl-1,3-benzothiazol-3-ium |
| SMILES | CCCC[n+]1c(/C=C/C=C2/N(C)c3cc4ccccc4cc3C2(C)Cc2ccccc2)sc2ccccc21 |
| InChI | InChI=1S/C35H35N2S/c1-4-5-22-37-30-18-11-12-19-32(30)38-34(37)21-13-20-33-35(2,25-26-14-7-6-8-15-26)29-23-27-16-9-10-17-28(27)24-31(29)36(33)3/h6-21,23-24H,4-5,22,25H2,1-3H3/q+1 |
| InChIKey | TVKKUUPJCRBUPU-UHFFFAOYSA-N |
| XLogP | 8.69 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.75 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|