C22H32O3 — CID 59217530
(9,9-dimethyl-8-tricyclo[5.2.1.02,6]decanyl)oxymethyl 2-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 59217530) has the molecular formula C22H32O3 and a molecular weight of 344.50 g/mol. Its IUPAC name is (9,9-dimethyl-8-tricyclo[5.2.1.02,6]decanyl)oxymethyl 2-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | (9,9-dimethyl-8-tricyclo[5.2.1.02,6]decanyl)oxymethyl 2-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 59217530 |
| Molecular Formula | C22H32O3 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | (9,9-dimethyl-8-tricyclo[5.2.1.02,6]decanyl)oxymethyl 2-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | CC1(C(=O)OCOC2C3CC(C4CCCC43)C2(C)C)CC2C=CC1C2 |
| InChI | InChI=1S/C22H32O3/c1-21(2)18-10-17(15-5-4-6-16(15)18)19(21)24-12-25-20(23)22(3)11-13-7-8-14(22)9-13/h7-8,13-19H,4-6,9-12H2,1-3H3 |
| InChIKey | CXLZQDLBAKMNDK-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|