C20H27F3O3 — CID 59217537
(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)oxymethyl 2-(trifluoromethyl)bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 59217537) has the molecular formula C20H27F3O3 and a molecular weight of 372.43 g/mol. Its IUPAC name is (1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)oxymethyl 2-(trifluoromethyl)bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | (1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)oxymethyl 2-(trifluoromethyl)bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 59217537 |
| Molecular Formula | C20H27F3O3 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | (1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)oxymethyl 2-(trifluoromethyl)bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | CC12CCC(C1)C(C)(C)C2OCOC(=O)C1(C(F)(F)F)CC2C=CC1C2 |
| InChI | InChI=1S/C20H27F3O3/c1-17(2)14-6-7-18(3,10-14)15(17)25-11-26-16(24)19(20(21,22)23)9-12-4-5-13(19)8-12/h4-5,12-15H,6-11H2,1-3H3 |
| InChIKey | XQJLAWJNAWLUML-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|