C26H22O7 — CID 59222159
(4-methoxyphenyl) 2-methyl-4-[4-(prop-2-enoyloxymethoxycarbonyl)phenyl]benzoate (PubChem CID 59222159) has the molecular formula C26H22O7 and a molecular weight of 446.46 g/mol. Its IUPAC name is (4-methoxyphenyl) 2-methyl-4-[4-(prop-2-enoyloxymethoxycarbonyl)phenyl]benzoate.
| Compound Name | (4-methoxyphenyl) 2-methyl-4-[4-(prop-2-enoyloxymethoxycarbonyl)phenyl]benzoate |
|---|---|
| PubChem CID | 59222159 |
| Molecular Formula | C26H22O7 |
| Molecular Weight | 446.46 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | (4-methoxyphenyl) 2-methyl-4-[4-(prop-2-enoyloxymethoxycarbonyl)phenyl]benzoate |
| SMILES | C=CC(=O)OCOC(=O)c1ccc(-c2ccc(C(=O)Oc3ccc(OC)cc3)c(C)c2)cc1 |
| InChI | InChI=1S/C26H22O7/c1-4-24(27)31-16-32-25(28)19-7-5-18(6-8-19)20-9-14-23(17(2)15-20)26(29)33-22-12-10-21(30-3)11-13-22/h4-15H,1,16H2,2-3H3 |
| InChIKey | UCSJODQSDZVRQB-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.46 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|