C13H8F5O7S- — CID 59222725
1,1,3,3,3-pentafluoro-2-(4-prop-2-enoyloxybenzoyl)oxypropane-1-sulfonate (PubChem CID 59222725) has the molecular formula C13H8F5O7S- and a molecular weight of 403.26 g/mol. Its IUPAC name is 1,1,3,3,3-pentafluoro-2-(4-prop-2-enoyloxybenzoyl)oxypropane-1-sulfonate.
| Compound Name | 1,1,3,3,3-pentafluoro-2-(4-prop-2-enoyloxybenzoyl)oxypropane-1-sulfonate |
|---|---|
| PubChem CID | 59222725 |
| Molecular Formula | C13H8F5O7S- |
| Molecular Weight | 403.26 g/mol |
| Exact Mass | 402.99 |
| IUPAC Name | 1,1,3,3,3-pentafluoro-2-(4-prop-2-enoyloxybenzoyl)oxypropane-1-sulfonate |
| SMILES | C=CC(=O)Oc1ccc(C(=O)OC(C(F)(F)F)C(F)(F)S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C13H9F5O7S/c1-2-9(19)24-8-5-3-7(4-6-8)10(20)25-11(12(14,15)16)13(17,18)26(21,22)23/h2-6,11H,1H2,(H,21,22,23)/p-1 |
| InChIKey | PNZMYOKHPGPBHT-UHFFFAOYSA-M |
| XLogP | 2.00 |
| TPSA | 109.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.26 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|