About methyl 4-propan-2-yloxybenzoate
methyl 4-propan-2-yloxybenzoate (PubChem CID 3015807) has the molecular formula C11H14O3
and a molecular weight of 194.23 g/mol. Its IUPAC name is methyl 4-propan-2-yloxybenzoate.
Molecular Properties
| Compound Name | methyl 4-propan-2-yloxybenzoate |
| PubChem CID | 3015807 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | methyl 4-propan-2-yloxybenzoate |
| SMILES | COC(=O)c1ccc(OC(C)C)cc1 |
| InChI | InChI=1S/C11H14O3/c1-8(2)14-10-6-4-9(5-7-10)11(12)13-3/h4-8H,1-3H3 |
| InChIKey | ROEMZKPINYTSKV-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 4-propan-2-yloxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-propan-2-yloxybenzoate?
The IUPAC name of methyl 4-propan-2-yloxybenzoate (CID 3015807) is methyl 4-propan-2-yloxybenzoate.
What is the SMILES notation for methyl 4-propan-2-yloxybenzoate?
The canonical SMILES for methyl 4-propan-2-yloxybenzoate is COC(=O)c1ccc(OC(C)C)cc1.
What is the InChIKey of methyl 4-propan-2-yloxybenzoate?
The InChIKey is ROEMZKPINYTSKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O3/c1-8(2)14-10-6-4-9(5-7-10)11(12)13-3/h4-8H,1-3H3.
What are the key properties of methyl 4-propan-2-yloxybenzoate?
methyl 4-propan-2-yloxybenzoate has a molecular weight of 194.23 g/mol, XLogP of 2.26, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-propan-2-yloxybenzoate is sourced from PubChem (CID 3015807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).