C15H24ClN5O3S — CID 59224707
tert-butyl N-[3-[3-(2-amino-6-chloropyrimidin-4-yl)sulfanylpropanoylamino]propyl]carbamate (PubChem CID 59224707) has the molecular formula C15H24ClN5O3S and a molecular weight of 389.91 g/mol. Its IUPAC name is tert-butyl N-[3-[3-(2-amino-6-chloropyrimidin-4-yl)sulfanylpropanoylamino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[3-(2-amino-6-chloropyrimidin-4-yl)sulfanylpropanoylamino]propyl]carbamate |
|---|---|
| PubChem CID | 59224707 |
| Molecular Formula | C15H24ClN5O3S |
| Molecular Weight | 389.91 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | tert-butyl N-[3-[3-(2-amino-6-chloropyrimidin-4-yl)sulfanylpropanoylamino]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCNC(=O)CCSc1cc(Cl)nc(N)n1 |
| InChI | InChI=1S/C15H24ClN5O3S/c1-15(2,3)24-14(23)19-7-4-6-18-11(22)5-8-25-12-9-10(16)20-13(17)21-12/h9H,4-8H2,1-3H3,(H,18,22)(H,19,23)(H2,17,20,21) |
| InChIKey | XFIIMRUHQZXCAK-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 119.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.91 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|