C18H20Cl2N4O4S — CID 69011468
5-[2-amino-6-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylsulfanyl]pyrimidin-4-yl]-2,4-dichlorobenzoic acid (PubChem CID 69011468) has the molecular formula C18H20Cl2N4O4S and a molecular weight of 459.36 g/mol. Its IUPAC name is 5-[2-amino-6-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylsulfanyl]pyrimidin-4-yl]-2,4-dichlorobenzoic acid.
| Compound Name | 5-[2-amino-6-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylsulfanyl]pyrimidin-4-yl]-2,4-dichlorobenzoic acid |
|---|---|
| PubChem CID | 69011468 |
| Molecular Formula | C18H20Cl2N4O4S |
| Molecular Weight | 459.36 g/mol |
| Exact Mass | 458.06 |
| IUPAC Name | 5-[2-amino-6-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylsulfanyl]pyrimidin-4-yl]-2,4-dichlorobenzoic acid |
| SMILES | CC(C)(C)OC(=O)NCCSc1cc(-c2cc(C(=O)O)c(Cl)cc2Cl)nc(N)n1 |
| InChI | InChI=1S/C18H20Cl2N4O4S/c1-18(2,3)28-17(27)22-4-5-29-14-8-13(23-16(21)24-14)9-6-10(15(25)26)12(20)7-11(9)19/h6-8H,4-5H2,1-3H3,(H,22,27)(H,25,26)(H2,21,23,24) |
| InChIKey | IFHZZKNORXJDMR-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 127.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.36 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|