C6H6ClN3O2S — CID 94830344
2-(2-amino-6-chloropyrimidin-4-yl)sulfanylacetic acid (PubChem CID 94830344) has the molecular formula C6H6ClN3O2S and a molecular weight of 219.65 g/mol. Its IUPAC name is 2-(2-amino-6-chloropyrimidin-4-yl)sulfanylacetic acid.
| Compound Name | 2-(2-amino-6-chloropyrimidin-4-yl)sulfanylacetic acid |
|---|---|
| PubChem CID | 94830344 |
| Molecular Formula | C6H6ClN3O2S |
| Molecular Weight | 219.65 g/mol |
| Exact Mass | 218.99 |
| IUPAC Name | 2-(2-amino-6-chloropyrimidin-4-yl)sulfanylacetic acid |
| SMILES | Nc1nc(Cl)cc(SCC(=O)O)n1 |
| InChI | InChI=1S/C6H6ClN3O2S/c7-3-1-4(10-6(8)9-3)13-2-5(11)12/h1H,2H2,(H,11,12)(H2,8,9,10) |
| InChIKey | UFWGDZQPHYRELB-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 89.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.65 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |