C8H10ClN3O2S — CID 163718705
4-(2-amino-6-chloropyrimidin-4-yl)sulfanyl-1-hydroxybutan-2-one (PubChem CID 163718705) has the molecular formula C8H10ClN3O2S and a molecular weight of 247.71 g/mol. Its IUPAC name is 4-(2-amino-6-chloropyrimidin-4-yl)sulfanyl-1-hydroxybutan-2-one.
| Compound Name | 4-(2-amino-6-chloropyrimidin-4-yl)sulfanyl-1-hydroxybutan-2-one |
|---|---|
| PubChem CID | 163718705 |
| Molecular Formula | C8H10ClN3O2S |
| Molecular Weight | 247.71 g/mol |
| Exact Mass | 247.02 |
| IUPAC Name | 4-(2-amino-6-chloropyrimidin-4-yl)sulfanyl-1-hydroxybutan-2-one |
| SMILES | Nc1nc(Cl)cc(SCCC(=O)CO)n1 |
| InChI | InChI=1S/C8H10ClN3O2S/c9-6-3-7(12-8(10)11-6)15-2-1-5(14)4-13/h3,13H,1-2,4H2,(H2,10,11,12) |
| InChIKey | KPPFQEWIXDAHMJ-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 89.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.71 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |