About 2-[(4-amino-6-chloro-1,3,5-triazin-2-yl)sulfanyl]acetic acid
2-[(4-amino-6-chloro-1,3,5-triazin-2-yl)sulfanyl]acetic acid (PubChem CID 21339614) has the molecular formula C5H5ClN4O2S
and a molecular weight of 220.64 g/mol. Its IUPAC name is 2-[(4-amino-6-chloro-1,3,5-triazin-2-yl)sulfanyl]acetic acid.
Analyze 2-[(4-amino-6-chloro-1,3,5-triazin-2-yl)sulfanyl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-amino-6-chloro-1,3,5-triazin-2-yl)sulfanyl]acetic acid?
The IUPAC name of 2-[(4-amino-6-chloro-1,3,5-triazin-2-yl)sulfanyl]acetic acid (CID 21339614) is 2-[(4-amino-6-chloro-1,3,5-triazin-2-yl)sulfanyl]acetic acid.
What is the SMILES notation for 2-[(4-amino-6-chloro-1,3,5-triazin-2-yl)sulfanyl]acetic acid?
The canonical SMILES for 2-[(4-amino-6-chloro-1,3,5-triazin-2-yl)sulfanyl]acetic acid is Nc1nc(Cl)nc(SCC(=O)O)n1.
What is the InChIKey of 2-[(4-amino-6-chloro-1,3,5-triazin-2-yl)sulfanyl]acetic acid?
The InChIKey is NHCSLZVLJAWWND-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5ClN4O2S/c6-3-8-4(7)10-5(9-3)13-1-2(11)12/h1H2,(H,11,12)(H2,7,8,9,10).
What are the key properties of 2-[(4-amino-6-chloro-1,3,5-triazin-2-yl)sulfanyl]acetic acid?
2-[(4-amino-6-chloro-1,3,5-triazin-2-yl)sulfanyl]acetic acid has a molecular weight of 220.64 g/mol, XLogP of 0.28, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-amino-6-chloro-1,3,5-triazin-2-yl)sulfanyl]acetic acid is sourced from PubChem (CID 21339614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).