C10H10F3N3OS — CID 59225759
ethynylimino-methyl-oxo-[1-[2-(trifluoromethyl)pyrimidin-5-yl]ethyl]-λ6-sulfane (PubChem CID 59225759) has the molecular formula C10H10F3N3OS and a molecular weight of 277.27 g/mol. Its IUPAC name is ethynylimino-methyl-oxo-[1-[2-(trifluoromethyl)pyrimidin-5-yl]ethyl]-λ6-sulfane.
| Compound Name | ethynylimino-methyl-oxo-[1-[2-(trifluoromethyl)pyrimidin-5-yl]ethyl]-λ6-sulfane |
|---|---|
| PubChem CID | 59225759 |
| Molecular Formula | C10H10F3N3OS |
| Molecular Weight | 277.27 g/mol |
| Exact Mass | 277.05 |
| IUPAC Name | ethynylimino-methyl-oxo-[1-[2-(trifluoromethyl)pyrimidin-5-yl]ethyl]-λ6-sulfane |
| SMILES | C#CN=S(C)(=O)C(C)c1cnc(C(F)(F)F)nc1 |
| InChI | InChI=1S/C10H10F3N3OS/c1-4-16-18(3,17)7(2)8-5-14-9(15-6-8)10(11,12)13/h1,5-7H,2-3H3 |
| InChIKey | YVKRIVCXEBVQLI-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 55.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.27 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|