C11H16F3N3OS — CID 66697944
2-methyl-N-[1-[2-(trifluoromethyl)pyrimidin-5-yl]ethyl]propane-2-sulfinamide (PubChem CID 66697944) has the molecular formula C11H16F3N3OS and a molecular weight of 295.33 g/mol. Its IUPAC name is 2-methyl-N-[1-[2-(trifluoromethyl)pyrimidin-5-yl]ethyl]propane-2-sulfinamide.
| Compound Name | 2-methyl-N-[1-[2-(trifluoromethyl)pyrimidin-5-yl]ethyl]propane-2-sulfinamide |
|---|---|
| PubChem CID | 66697944 |
| Molecular Formula | C11H16F3N3OS |
| Molecular Weight | 295.33 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 2-methyl-N-[1-[2-(trifluoromethyl)pyrimidin-5-yl]ethyl]propane-2-sulfinamide |
| SMILES | CC(NS(=O)C(C)(C)C)c1cnc(C(F)(F)F)nc1 |
| InChI | InChI=1S/C11H16F3N3OS/c1-7(17-19(18)10(2,3)4)8-5-15-9(16-6-8)11(12,13)14/h5-7,17H,1-4H3 |
| InChIKey | UCIRJFZSOBBXDU-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.33 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |