C29H41N2O4+ — CID 59226194
(R)-cyclohexyl-[5-[[(3R)-3-(oxan-2-yloxy)-1-azoniabicyclo[2.2.2]octan-1-yl]methyl]-1,3-oxazol-2-yl]-phenylmethanol (PubChem CID 59226194) has the molecular formula C29H41N2O4+ and a molecular weight of 481.66 g/mol. Its IUPAC name is (R)-cyclohexyl-[5-[[(3R)-3-(oxan-2-yloxy)-1-azoniabicyclo[2.2.2]octan-1-yl]methyl]-1,3-oxazol-2-yl]-phenylmethanol.
| Compound Name | (R)-cyclohexyl-[5-[[(3R)-3-(oxan-2-yloxy)-1-azoniabicyclo[2.2.2]octan-1-yl]methyl]-1,3-oxazol-2-yl]-phenylmethanol |
|---|---|
| PubChem CID | 59226194 |
| Molecular Formula | C29H41N2O4+ |
| Molecular Weight | 481.66 g/mol |
| Exact Mass | 481.31 |
| IUPAC Name | (R)-cyclohexyl-[5-[[(3R)-3-(oxan-2-yloxy)-1-azoniabicyclo[2.2.2]octan-1-yl]methyl]-1,3-oxazol-2-yl]-phenylmethanol |
| SMILES | O[C@](c1ccccc1)(c1ncc(C[N+]23CCC(CC2)[C@@H](OC2CCCCO2)C3)o1)C1CCCCC1 |
| InChI | InChI=1S/C29H41N2O4/c32-29(23-9-3-1-4-10-23,24-11-5-2-6-12-24)28-30-19-25(34-28)20-31-16-14-22(15-17-31)26(21-31)35-27-13-7-8-18-33-27/h1,3-4,9-10,19,22,24,26-27,32H,2,5-8,11-18,20-21H2/q+1/t22?,26-,27?,29-,31?/m0/s1 |
| InChIKey | JUFSQVUVJVWXIM-WUCCEPKOSA-N |
| XLogP | 5.14 |
| TPSA | 64.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.66 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|