C11H20O2 — CID 59227326
(4S,6R)-2-methylidene-4,6-di(propan-2-yl)-1,3-dioxane (PubChem CID 59227326) has the molecular formula C11H20O2 and a molecular weight of 184.28 g/mol. Its IUPAC name is (4S,6R)-2-methylidene-4,6-di(propan-2-yl)-1,3-dioxane.
| Compound Name | (4S,6R)-2-methylidene-4,6-di(propan-2-yl)-1,3-dioxane |
|---|---|
| PubChem CID | 59227326 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | (4S,6R)-2-methylidene-4,6-di(propan-2-yl)-1,3-dioxane |
| SMILES | C=C1O[C@H](C(C)C)C[C@H](C(C)C)O1 |
| InChI | InChI=1S/C11H20O2/c1-7(2)10-6-11(8(3)4)13-9(5)12-10/h7-8,10-11H,5-6H2,1-4H3/t10-,11+ |
| InChIKey | HAMSTZCXRVOXRA-PHIMTYICSA-N |
| XLogP | 2.94 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |