C18H16O2 — CID 59227588
2-(1-phenyl-3,4-dihydronaphthalen-2-yl)acetic acid (PubChem CID 59227588) has the molecular formula C18H16O2 and a molecular weight of 264.32 g/mol. Its IUPAC name is 2-(1-phenyl-3,4-dihydronaphthalen-2-yl)acetic acid.
| Compound Name | 2-(1-phenyl-3,4-dihydronaphthalen-2-yl)acetic acid |
|---|---|
| PubChem CID | 59227588 |
| Molecular Formula | C18H16O2 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 2-(1-phenyl-3,4-dihydronaphthalen-2-yl)acetic acid |
| SMILES | O=C(O)CC1=C(c2ccccc2)c2ccccc2CC1 |
| InChI | InChI=1S/C18H16O2/c19-17(20)12-15-11-10-13-6-4-5-9-16(13)18(15)14-7-2-1-3-8-14/h1-9H,10-12H2,(H,19,20) |
| InChIKey | AZTLPPZBGGLLSW-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |