C17H16S — CID 164667981
3-methylsulfanyl-4-phenyl-1,2-dihydronaphthalene (PubChem CID 164667981) has the molecular formula C17H16S and a molecular weight of 252.38 g/mol. Its IUPAC name is 3-methylsulfanyl-4-phenyl-1,2-dihydronaphthalene.
| Compound Name | 3-methylsulfanyl-4-phenyl-1,2-dihydronaphthalene |
|---|---|
| PubChem CID | 164667981 |
| Molecular Formula | C17H16S |
| Molecular Weight | 252.38 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | 3-methylsulfanyl-4-phenyl-1,2-dihydronaphthalene |
| SMILES | CSC1=C(c2ccccc2)c2ccccc2CC1 |
| InChI | InChI=1S/C17H16S/c1-18-16-12-11-13-7-5-6-10-15(13)17(16)14-8-3-2-4-9-14/h2-10H,11-12H2,1H3 |
| InChIKey | ORJXIWGKHNYYOM-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.38 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |