C18H22N2O4S — CID 59230979
N-[4-[[(7-methyl-1,3-benzodioxol-5-yl)amino]methyl]phenyl]propane-2-sulfonamide (PubChem CID 59230979) has the molecular formula C18H22N2O4S and a molecular weight of 362.45 g/mol. Its IUPAC name is N-[4-[[(7-methyl-1,3-benzodioxol-5-yl)amino]methyl]phenyl]propane-2-sulfonamide.
| Compound Name | N-[4-[[(7-methyl-1,3-benzodioxol-5-yl)amino]methyl]phenyl]propane-2-sulfonamide |
|---|---|
| PubChem CID | 59230979 |
| Molecular Formula | C18H22N2O4S |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | N-[4-[[(7-methyl-1,3-benzodioxol-5-yl)amino]methyl]phenyl]propane-2-sulfonamide |
| SMILES | Cc1cc(NCc2ccc(NS(=O)(=O)C(C)C)cc2)cc2c1OCO2 |
| InChI | InChI=1S/C18H22N2O4S/c1-12(2)25(21,22)20-15-6-4-14(5-7-15)10-19-16-8-13(3)18-17(9-16)23-11-24-18/h4-9,12,19-20H,10-11H2,1-3H3 |
| InChIKey | YVJOSFQYDNMRDT-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|