C20H19BClF5N2O3 — CID 59232193
1-[2-chloro-5-(trifluoromethyl)phenyl]-3-[2,5-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]urea (PubChem CID 59232193) has the molecular formula C20H19BClF5N2O3 and a molecular weight of 476.64 g/mol. Its IUPAC name is 1-[2-chloro-5-(trifluoromethyl)phenyl]-3-[2,5-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]urea.
| Compound Name | 1-[2-chloro-5-(trifluoromethyl)phenyl]-3-[2,5-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]urea |
|---|---|
| PubChem CID | 59232193 |
| Molecular Formula | C20H19BClF5N2O3 |
| Molecular Weight | 476.64 g/mol |
| Exact Mass | 476.11 |
| IUPAC Name | 1-[2-chloro-5-(trifluoromethyl)phenyl]-3-[2,5-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]urea |
| SMILES | CC1(C)OB(c2cc(F)c(NC(=O)Nc3cc(C(F)(F)F)ccc3Cl)cc2F)OC1(C)C |
| InChI | InChI=1S/C20H19BClF5N2O3/c1-18(2)19(3,4)32-21(31-18)11-8-14(24)16(9-13(11)23)29-17(30)28-15-7-10(20(25,26)27)5-6-12(15)22/h5-9H,1-4H3,(H2,28,29,30) |
| InChIKey | MWENRTRDZDSLII-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.64 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|